C16H16N2O7S2 — CID 88733862
(6R)-4-methyl-8-oxo-7-[(2-phenyl-2-sulfoacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid (PubChem CID 88733862) has the molecular formula C16H16N2O7S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is (6R)-4-methyl-8-oxo-7-[(2-phenyl-2-sulfoacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid.
| Compound Name | (6R)-4-methyl-8-oxo-7-[(2-phenyl-2-sulfoacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 88733862 |
| Molecular Formula | C16H16N2O7S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | (6R)-4-methyl-8-oxo-7-[(2-phenyl-2-sulfoacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid |
| SMILES | CC1S[C@@H]2C(NC(=O)C(c3ccccc3)S(=O)(=O)O)C(=O)N2C=C1C(=O)O |
| InChI | InChI=1S/C16H16N2O7S2/c1-8-10(16(21)22)7-18-14(20)11(15(18)26-8)17-13(19)12(27(23,24)25)9-5-3-2-4-6-9/h2-8,11-12,15H,1H3,(H,17,19)(H,21,22)(H,23,24,25)/t8?,11?,12?,15-/m1/s1 |
| InChIKey | YHJWTNSMNYOQOP-PUPLRSCJSA-N |
| XLogP | 0.37 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|