C19H18ClN6NaO8S2 — CID 88628859
sodium 3-[[2-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate (PubChem CID 88628859) has the molecular formula C19H18ClN6NaO8S2 and a molecular weight of 580.96 g/mol. Its IUPAC name is sodium 3-[[2-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | sodium 3-[[2-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 88628859 |
| Molecular Formula | C19H18ClN6NaO8S2 |
| Molecular Weight | 580.96 g/mol |
| Exact Mass | 580.02 |
| IUPAC Name | sodium 3-[[2-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-phenylacetyl]amino]-2-oxoazetidine-1-sulfonate |
| SMILES | CO/N=C(\C(=O)NC(C(=O)NC1CN(S(=O)(=O)[O-])C1=O)c1ccccc1)c1csc(NC(=O)CCl)n1.[Na+] |
| InChI | InChI=1S/C19H19ClN6O8S2.Na/c1-34-25-15(12-9-35-19(22-12)23-13(27)7-20)17(29)24-14(10-5-3-2-4-6-10)16(28)21-11-8-26(18(11)30)36(31,32)33;/h2-6,9,11,14H,7-8H2,1H3,(H,21,28)(H,24,29)(H,22,23,27)(H,31,32,33);/q;+1/p-1/b25-15-; |
| InChIKey | ZTNVHPXMZNYHDF-WMJMVBMNSA-M |
| XLogP | -3.68 |
| TPSA | 199.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.96 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|