C12H15ClN5NaO7S2 — CID 88659659
sodium (2S,3S)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-methyl-1-oxidoazetidin-1-ium-1-sulfonate (PubChem CID 88659659) has the molecular formula C12H15ClN5NaO7S2 and a molecular weight of 463.86 g/mol. Its IUPAC name is sodium (2S,3S)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-methyl-1-oxidoazetidin-1-ium-1-sulfonate.
| Compound Name | sodium (2S,3S)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-methyl-1-oxidoazetidin-1-ium-1-sulfonate |
|---|---|
| PubChem CID | 88659659 |
| Molecular Formula | C12H15ClN5NaO7S2 |
| Molecular Weight | 463.86 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | sodium (2S,3S)-3-[[(2Z)-2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-methyl-1-oxidoazetidin-1-ium-1-sulfonate |
| SMILES | CO/N=C(\C(=O)N[C@H]1C[N+]([O-])(S(=O)(=O)[O-])[C@H]1C)c1csc(NC(=O)CCl)n1.[Na+] |
| InChI | InChI=1S/C12H16ClN5O7S2.Na/c1-6-7(4-18(6,21)27(22,23)24)14-11(20)10(17-25-2)8-5-26-12(15-8)16-9(19)3-13;/h5-7H,3-4H2,1-2H3,(H,14,20)(H,15,16,19)(H,22,23,24);/q;+1/p-1/b17-10-;/t6-,7-,18?;/m0./s1 |
| InChIKey | FSTINCSJTXLORS-CJIHTPRHSA-M |
| XLogP | -3.66 |
| TPSA | 172.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.86 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|