C14H16ClN5O9S3 — CID 86740424
(2S,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(2-methoxy-2-oxoethyl)sulfanyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 86740424) has the molecular formula C14H16ClN5O9S3 and a molecular weight of 529.96 g/mol. Its IUPAC name is (2S,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(2-methoxy-2-oxoethyl)sulfanyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(2-methoxy-2-oxoethyl)sulfanyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 86740424 |
| Molecular Formula | C14H16ClN5O9S3 |
| Molecular Weight | 529.96 g/mol |
| Exact Mass | 528.98 |
| IUPAC Name | (2S,3R)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-2-(2-methoxy-2-oxoethyl)sulfanyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N(S(=O)(=O)O)[C@H]1SCC(=O)OC)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C14H16ClN5O9S3/c1-28-8(22)5-30-13-10(12(24)20(13)32(25,26)27)18-11(23)9(19-29-2)6-4-31-14(16-6)17-7(21)3-15/h4,10,13H,3,5H2,1-2H3,(H,18,23)(H,16,17,21)(H,25,26,27)/t10-,13+/m1/s1 |
| InChIKey | XASTWXXLORXLCW-MFKMUULPSA-N |
| XLogP | -0.97 |
| TPSA | 193.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.96 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|