C19H17ClN5NaO9S2 — CID 88628240
sodium (2R,3R)-2-(benzoyloxymethyl)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonate (PubChem CID 88628240) has the molecular formula C19H17ClN5NaO9S2 and a molecular weight of 581.95 g/mol. Its IUPAC name is sodium (2R,3R)-2-(benzoyloxymethyl)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonate.
| Compound Name | sodium (2R,3R)-2-(benzoyloxymethyl)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 88628240 |
| Molecular Formula | C19H17ClN5NaO9S2 |
| Molecular Weight | 581.95 g/mol |
| Exact Mass | 581.01 |
| IUPAC Name | sodium (2R,3R)-2-(benzoyloxymethyl)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonate |
| SMILES | CON=C(C(=O)N[C@H]1C(=O)N(S(=O)(=O)[O-])[C@H]1COC(=O)c1ccccc1)c1csc(NC(=O)CCl)n1.[Na+] |
| InChI | InChI=1S/C19H18ClN5O9S2.Na/c1-33-24-14(11-9-35-19(21-11)22-13(26)7-20)16(27)23-15-12(25(17(15)28)36(30,31)32)8-34-18(29)10-5-3-2-4-6-10;/h2-6,9,12,15H,7-8H2,1H3,(H,23,27)(H,21,22,26)(H,30,31,32);/q;+1/p-1/t12-,15+;/m0./s1 |
| InChIKey | HBFHDAISXGOQEC-SBKWZQTDSA-M |
| XLogP | -3.31 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.95 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|