C11H11Cl2N5O8S — CID 173434599
3-[[2-[5-[(2,2-dichloroacetyl)amino]-1,3-oxazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxoazetidine-1-sulfonic acid (PubChem CID 173434599) has the molecular formula C11H11Cl2N5O8S and a molecular weight of 444.21 g/mol. Its IUPAC name is 3-[[2-[5-[(2,2-dichloroacetyl)amino]-1,3-oxazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxoazetidine-1-sulfonic acid.
| Compound Name | 3-[[2-[5-[(2,2-dichloroacetyl)amino]-1,3-oxazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 173434599 |
| Molecular Formula | C11H11Cl2N5O8S |
| Molecular Weight | 444.21 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | 3-[[2-[5-[(2,2-dichloroacetyl)amino]-1,3-oxazol-4-yl]-2-methoxyiminoacetyl]amino]-2-oxoazetidine-1-sulfonic acid |
| SMILES | CON=C(C(=O)NC1CN(S(=O)(=O)O)C1=O)c1ncoc1NC(=O)C(Cl)Cl |
| InChI | InChI=1S/C11H11Cl2N5O8S/c1-25-17-5(6-10(26-3-14-6)16-9(20)7(12)13)8(19)15-4-2-18(11(4)21)27(22,23)24/h3-4,7H,2H2,1H3,(H,15,19)(H,16,20)(H,22,23,24) |
| InChIKey | WVLCXCYAVNFMQM-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 180.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.21 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|