C13H14ClN5O8S2 — CID 88706131
2-acetyl-3-[[(2Z)-2-[2-(2-amino-1-chloro-2-oxoethyl)-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid (PubChem CID 88706131) has the molecular formula C13H14ClN5O8S2 and a molecular weight of 467.87 g/mol. Its IUPAC name is 2-acetyl-3-[[(2Z)-2-[2-(2-amino-1-chloro-2-oxoethyl)-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid.
| Compound Name | 2-acetyl-3-[[(2Z)-2-[2-(2-amino-1-chloro-2-oxoethyl)-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 88706131 |
| Molecular Formula | C13H14ClN5O8S2 |
| Molecular Weight | 467.87 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 2-acetyl-3-[[(2Z)-2-[2-(2-amino-1-chloro-2-oxoethyl)-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-4-oxoazetidine-1-sulfonic acid |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N(S(=O)(=O)O)C1C(C)=O)c1csc(C(Cl)C(N)=O)n1 |
| InChI | InChI=1S/C13H14ClN5O8S2/c1-4(20)9-8(13(23)19(9)29(24,25)26)17-11(22)7(18-27-2)5-3-28-12(16-5)6(14)10(15)21/h3,6,8-9H,1-2H3,(H2,15,21)(H,17,22)(H,24,25,26)/b18-7- |
| InChIKey | DVZVRFCYBXOEER-WSVATBPTSA-N |
| XLogP | -1.65 |
| TPSA | 198.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.87 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|