C12H13KN2O7S — CID 23680735
potassium (3S)-3-[(2,6-dimethoxybenzoyl)amino]-2-oxoazetidine-1-sulfonate (PubChem CID 23680735) has the molecular formula C12H13KN2O7S and a molecular weight of 368.41 g/mol. Its IUPAC name is potassium (3S)-3-[(2,6-dimethoxybenzoyl)amino]-2-oxoazetidine-1-sulfonate.
| Compound Name | potassium (3S)-3-[(2,6-dimethoxybenzoyl)amino]-2-oxoazetidine-1-sulfonate |
|---|---|
| PubChem CID | 23680735 |
| Molecular Formula | C12H13KN2O7S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | potassium (3S)-3-[(2,6-dimethoxybenzoyl)amino]-2-oxoazetidine-1-sulfonate |
| SMILES | COc1cccc(OC)c1C(=O)N[C@H]1CN(S(=O)(=O)[O-])C1=O.[K+] |
| InChI | InChI=1S/C12H14N2O7S.K/c1-20-8-4-3-5-9(21-2)10(8)11(15)13-7-6-14(12(7)16)22(17,18)19;/h3-5,7H,6H2,1-2H3,(H,13,15)(H,17,18,19);/q;+1/p-1/t7-;/m0./s1 |
| InChIKey | SNISUIJRFWCRDX-FJXQXJEOSA-M |
| XLogP | -3.89 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | -3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|