C13H16N2O8S — CID 70482727
[(3S)-3-[(2,6-dimethoxybenzoyl)amino]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate (PubChem CID 70482727) has the molecular formula C13H16N2O8S and a molecular weight of 360.34 g/mol. Its IUPAC name is [(3S)-3-[(2,6-dimethoxybenzoyl)amino]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate.
| Compound Name | [(3S)-3-[(2,6-dimethoxybenzoyl)amino]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 70482727 |
| Molecular Formula | C13H16N2O8S |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [(3S)-3-[(2,6-dimethoxybenzoyl)amino]-2-methyl-4-oxoazetidin-1-yl] hydrogen sulfate |
| SMILES | COc1cccc(OC)c1C(=O)N[C@@H]1C(=O)N(OS(=O)(=O)O)C1C |
| InChI | InChI=1S/C13H16N2O8S/c1-7-11(13(17)15(7)23-24(18,19)20)14-12(16)10-8(21-2)5-4-6-9(10)22-3/h4-7,11H,1-3H3,(H,14,16)(H,18,19,20)/t7?,11-/m0/s1 |
| InChIKey | MQPSFPILHAUGMS-QRIDDKLISA-N |
| XLogP | -0.23 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|