C11H15N3O4 — CID 10658517
N-(2-hydrazinyl-2-oxoethyl)-2,6-dimethoxybenzamide (PubChem CID 10658517) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is N-(2-hydrazinyl-2-oxoethyl)-2,6-dimethoxybenzamide.
| Compound Name | N-(2-hydrazinyl-2-oxoethyl)-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 10658517 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(2-hydrazinyl-2-oxoethyl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCC(=O)NN |
| InChI | InChI=1S/C11H15N3O4/c1-17-7-4-3-5-8(18-2)10(7)11(16)13-6-9(15)14-12/h3-5H,6,12H2,1-2H3,(H,13,16)(H,14,15) |
| InChIKey | CNEKEGCBFMSVFN-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|