C11H16BNO5 — CID 52948893
[(1S)-1-[(2,6-dimethoxybenzoyl)amino]ethyl]boronic acid (PubChem CID 52948893) has the molecular formula C11H16BNO5 and a molecular weight of 253.06 g/mol. Its IUPAC name is [(1S)-1-[(2,6-dimethoxybenzoyl)amino]ethyl]boronic acid.
| Compound Name | [(1S)-1-[(2,6-dimethoxybenzoyl)amino]ethyl]boronic acid |
|---|---|
| PubChem CID | 52948893 |
| Molecular Formula | C11H16BNO5 |
| Molecular Weight | 253.06 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | [(1S)-1-[(2,6-dimethoxybenzoyl)amino]ethyl]boronic acid |
| SMILES | COc1cccc(OC)c1C(=O)N[C@H](C)B(O)O |
| InChI | InChI=1S/C11H16BNO5/c1-7(12(15)16)13-11(14)10-8(17-2)5-4-6-9(10)18-3/h4-7,15-16H,1-3H3,(H,13,14)/t7-/m1/s1 |
| InChIKey | DXKXQRZEPYKFAT-SSDOTTSWSA-N |
| XLogP | -0.17 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.06 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|