C13H16N2O4 — CID 173418970
2,6-dimethoxy-N-[(2S,3S)-2-methyl-4-oxoazetidin-3-yl]benzamide (PubChem CID 173418970) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[(2S,3S)-2-methyl-4-oxoazetidin-3-yl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[(2S,3S)-2-methyl-4-oxoazetidin-3-yl]benzamide |
|---|---|
| PubChem CID | 173418970 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2,6-dimethoxy-N-[(2S,3S)-2-methyl-4-oxoazetidin-3-yl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)N[C@@H]1C(=O)N[C@H]1C |
| InChI | InChI=1S/C13H16N2O4/c1-7-11(13(17)14-7)15-12(16)10-8(18-2)5-4-6-9(10)19-3/h4-7,11H,1-3H3,(H,14,17)(H,15,16)/t7-,11-/m0/s1 |
| InChIKey | JRJZGPLLMQGLNH-CPCISQLKSA-N |
| XLogP | 0.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |