C13H15N3O5 — CID 110722270
N-[(2,5-dioxoimidazolidin-4-yl)methyl]-2,6-dimethoxybenzamide (PubChem CID 110722270) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is N-[(2,5-dioxoimidazolidin-4-yl)methyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[(2,5-dioxoimidazolidin-4-yl)methyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 110722270 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[(2,5-dioxoimidazolidin-4-yl)methyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCC1NC(=O)NC1=O |
| InChI | InChI=1S/C13H15N3O5/c1-20-8-4-3-5-9(21-2)10(8)12(18)14-6-7-11(17)16-13(19)15-7/h3-5,7H,6H2,1-2H3,(H,14,18)(H2,15,16,17,19) |
| InChIKey | HGPZHYNYSAOWQX-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|