C14H17N3O4 — CID 110743578
N-[(2,5-dioxoimidazolidin-4-yl)methyl]-2-(4-ethoxyphenyl)acetamide (PubChem CID 110743578) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[(2,5-dioxoimidazolidin-4-yl)methyl]-2-(4-ethoxyphenyl)acetamide.
| Compound Name | N-[(2,5-dioxoimidazolidin-4-yl)methyl]-2-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 110743578 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-[(2,5-dioxoimidazolidin-4-yl)methyl]-2-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(CC(=O)NCC2NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C14H17N3O4/c1-2-21-10-5-3-9(4-6-10)7-12(18)15-8-11-13(19)17-14(20)16-11/h3-6,11H,2,7-8H2,1H3,(H,15,18)(H2,16,17,19,20) |
| InChIKey | MRBJYSDBAULGGY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|