C13H13F3N6O3S — CID 139656936
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[5-oxo-3-(trifluoromethyl)-6,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]acetamide (PubChem CID 139656936) has the molecular formula C13H13F3N6O3S and a molecular weight of 390.35 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[5-oxo-3-(trifluoromethyl)-6,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]acetamide.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[5-oxo-3-(trifluoromethyl)-6,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]acetamide |
|---|---|
| PubChem CID | 139656936 |
| Molecular Formula | C13H13F3N6O3S |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-[5-oxo-3-(trifluoromethyl)-6,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]acetamide |
| SMILES | CO/N=C(\C(=O)NC1CN2CC=C(C(F)(F)F)N2C1=O)c1csc(N)n1 |
| InChI | InChI=1S/C13H13F3N6O3S/c1-25-20-9(7-5-26-12(17)19-7)10(23)18-6-4-21-3-2-8(13(14,15)16)22(21)11(6)24/h2,5-6H,3-4H2,1H3,(H2,17,19)(H,18,23)/b20-9- |
| InChIKey | DOYZBCIBCVBLKM-UKWGHVSLSA-N |
| XLogP | 0.08 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|