C19H32N4O6S — CID 172934825
tert-butyl 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-(2,2-diethoxyethylamino)-2-oxoethylidene]amino]oxy-2-methylpropanoate (PubChem CID 172934825) has the molecular formula C19H32N4O6S and a molecular weight of 444.55 g/mol. Its IUPAC name is tert-butyl 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-(2,2-diethoxyethylamino)-2-oxoethylidene]amino]oxy-2-methylpropanoate.
| Compound Name | tert-butyl 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-(2,2-diethoxyethylamino)-2-oxoethylidene]amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 172934825 |
| Molecular Formula | C19H32N4O6S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | tert-butyl 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-(2,2-diethoxyethylamino)-2-oxoethylidene]amino]oxy-2-methylpropanoate |
| SMILES | CCOC(CNC(=O)/C(=N\OC(C)(C)C(=O)OC(C)(C)C)c1csc(N)n1)OCC |
| InChI | InChI=1S/C19H32N4O6S/c1-8-26-13(27-9-2)10-21-15(24)14(12-11-30-17(20)22-12)23-29-19(6,7)16(25)28-18(3,4)5/h11,13H,8-10H2,1-7H3,(H2,20,22)(H,21,24)/b23-14- |
| InChIKey | LYHHVZHTJVBFBA-UCQKPKSFSA-N |
| XLogP | 2.08 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|