C14H15N5O3S — CID 54318882
N-(2-aminoacetyl)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-phenylacetamide (PubChem CID 54318882) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is N-(2-aminoacetyl)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-phenylacetamide.
| Compound Name | N-(2-aminoacetyl)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-phenylacetamide |
|---|---|
| PubChem CID | 54318882 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-(2-aminoacetyl)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyimino-N-phenylacetamide |
| SMILES | CON=C(C(=O)N(C(=O)CN)c1ccccc1)c1csc(N)n1 |
| InChI | InChI=1S/C14H15N5O3S/c1-22-18-12(10-8-23-14(16)17-10)13(21)19(11(20)7-15)9-5-3-2-4-6-9/h2-6,8H,7,15H2,1H3,(H2,16,17) |
| InChIKey | SQEQWKGTEBZIPF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|