C12H17N3O2S — CID 54342715
2-(2-amino-1,3-thiazol-4-yl)-2-cycloheptyloxyiminoacetaldehyde (PubChem CID 54342715) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-2-cycloheptyloxyiminoacetaldehyde.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-2-cycloheptyloxyiminoacetaldehyde |
|---|---|
| PubChem CID | 54342715 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-2-cycloheptyloxyiminoacetaldehyde |
| SMILES | Nc1nc(C(C=O)=NOC2CCCCCC2)cs1 |
| InChI | InChI=1S/C12H17N3O2S/c13-12-14-11(8-18-12)10(7-16)15-17-9-5-3-1-2-4-6-9/h7-9H,1-6H2,(H2,13,14) |
| InChIKey | NIXWJYIWHKOSIN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|