C8H9N3O4S — CID 173396102
methyl 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetate (PubChem CID 173396102) has the molecular formula C8H9N3O4S and a molecular weight of 243.24 g/mol. Its IUPAC name is methyl 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetate.
| Compound Name | methyl 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 173396102 |
| Molecular Formula | C8H9N3O4S |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | methyl 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-oxoethylidene]amino]oxyacetate |
| SMILES | COC(=O)CO/N=C(/C=O)c1csc(N)n1 |
| InChI | InChI=1S/C8H9N3O4S/c1-14-7(13)3-15-11-5(2-12)6-4-16-8(9)10-6/h2,4H,3H2,1H3,(H2,9,10)/b11-5- |
| InChIKey | ROTQLHHTQCSBFD-WZUFQYTHSA-N |
| XLogP | -0.18 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|