C7H7F2N3O2S — CID 23038129
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2,2-difluoroethoxyimino)acetaldehyde (PubChem CID 23038129) has the molecular formula C7H7F2N3O2S and a molecular weight of 235.21 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2,2-difluoroethoxyimino)acetaldehyde.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2,2-difluoroethoxyimino)acetaldehyde |
|---|---|
| PubChem CID | 23038129 |
| Molecular Formula | C7H7F2N3O2S |
| Molecular Weight | 235.21 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2,2-difluoroethoxyimino)acetaldehyde |
| SMILES | Nc1nc(/C(C=O)=N/OCC(F)F)cs1 |
| InChI | InChI=1S/C7H7F2N3O2S/c8-6(9)2-14-12-4(1-13)5-3-15-7(10)11-5/h1,3,6H,2H2,(H2,10,11)/b12-4+ |
| InChIKey | LWVBWKJGZVHVLJ-UUILKARUSA-N |
| XLogP | 0.91 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|