C16H15BF2N4O6S — CID 142485189
(3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2,2-difluoroethoxyimino)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 142485189) has the molecular formula C16H15BF2N4O6S and a molecular weight of 440.19 g/mol. Its IUPAC name is (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2,2-difluoroethoxyimino)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2,2-difluoroethoxyimino)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 142485189 |
| Molecular Formula | C16H15BF2N4O6S |
| Molecular Weight | 440.19 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(2,2-difluoroethoxyimino)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | Nc1nc(/C(=N/OCC(F)F)C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)cs1 |
| InChI | InChI=1S/C16H15BF2N4O6S/c18-11(19)5-28-23-12(9-6-30-16(20)21-9)14(24)22-10-4-7-2-1-3-8(15(25)26)13(7)29-17(10)27/h1-3,6,10-11,27H,4-5H2,(H2,20,21)(H,22,24)(H,25,26)/b23-12-/t10-/m0/s1 |
| InChIKey | SLRMZDVPJNYTMG-VDZLYJHLSA-N |
| XLogP | 0.55 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|