C21H24BN5O7S — CID 172953886
(3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-2-oxo-3-(2-oxo-2-piperazin-1-ylethoxy)iminopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 172953886) has the molecular formula C21H24BN5O7S and a molecular weight of 501.33 g/mol. Its IUPAC name is (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-2-oxo-3-(2-oxo-2-piperazin-1-ylethoxy)iminopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-2-oxo-3-(2-oxo-2-piperazin-1-ylethoxy)iminopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 172953886 |
| Molecular Formula | C21H24BN5O7S |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-2-oxo-3-(2-oxo-2-piperazin-1-ylethoxy)iminopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | Nc1nc(/C(=N/OCC(=O)N2CCNCC2)C(=O)C[C@H]2Cc3cccc(C(=O)O)c3OB2O)cs1 |
| InChI | InChI=1S/C21H24BN5O7S/c23-21-25-15(11-35-21)18(26-33-10-17(29)27-6-4-24-5-7-27)16(28)9-13-8-12-2-1-3-14(20(30)31)19(12)34-22(13)32/h1-3,11,13,24,32H,4-10H2,(H2,23,25)(H,30,31)/b26-18-/t13-/m1/s1 |
| InChIKey | VWFKPNJPXMSJBQ-XPHVRJPMSA-N |
| XLogP | 0.02 |
| TPSA | 176.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|