C17H16BN3O8S — CID 172958588
(3R)-3-[(3Z)-3-[2-(carboxymethylamino)-1,3-thiazol-4-yl]-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 172958588) has the molecular formula C17H16BN3O8S and a molecular weight of 433.21 g/mol. Its IUPAC name is (3R)-3-[(3Z)-3-[2-(carboxymethylamino)-1,3-thiazol-4-yl]-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[(3Z)-3-[2-(carboxymethylamino)-1,3-thiazol-4-yl]-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 172958588 |
| Molecular Formula | C17H16BN3O8S |
| Molecular Weight | 433.21 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | (3R)-3-[(3Z)-3-[2-(carboxymethylamino)-1,3-thiazol-4-yl]-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(O)CNc1nc(/C(=N/O)C(=O)C[C@H]2Cc3cccc(C(=O)O)c3OB2O)cs1 |
| InChI | InChI=1S/C17H16BN3O8S/c22-12(14(21-28)11-7-30-17(20-11)19-6-13(23)24)5-9-4-8-2-1-3-10(16(25)26)15(8)29-18(9)27/h1-3,7,9,27-28H,4-6H2,(H,19,20)(H,23,24)(H,25,26)/b21-14-/t9-/m1/s1 |
| InChIKey | NSSXCWNJZIWOJV-YSRLARHESA-N |
| XLogP | 0.96 |
| TPSA | 178.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|