C17H18BClN4O6S — CID 142485065
(3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3-chloropropoxyimino)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 142485065) has the molecular formula C17H18BClN4O6S and a molecular weight of 452.69 g/mol. Its IUPAC name is (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3-chloropropoxyimino)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3-chloropropoxyimino)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 142485065 |
| Molecular Formula | C17H18BClN4O6S |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(3-chloropropoxyimino)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | Nc1nc(/C(=N/OCCCCl)C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)cs1 |
| InChI | InChI=1S/C17H18BClN4O6S/c19-5-2-6-28-23-13(11-8-30-17(20)21-11)15(24)22-12-7-9-3-1-4-10(16(25)26)14(9)29-18(12)27/h1,3-4,8,12,27H,2,5-7H2,(H2,20,21)(H,22,24)(H,25,26)/b23-13-/t12-/m0/s1 |
| InChIKey | TYXMYNNFJKGRKT-FBYPQVGPSA-N |
| XLogP | 0.91 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|