C18H20BN5O7S — CID 142485110
(3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[1-(methylamino)-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 142485110) has the molecular formula C18H20BN5O7S and a molecular weight of 461.27 g/mol. Its IUPAC name is (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[1-(methylamino)-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[1-(methylamino)-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 142485110 |
| Molecular Formula | C18H20BN5O7S |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[1-(methylamino)-1-oxopropan-2-yl]oxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CNC(=O)C(C)O/N=C(\C(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O)c1csc(N)n1 |
| InChI | InChI=1S/C18H20BN5O7S/c1-8(15(25)21-2)31-24-13(11-7-32-18(20)22-11)16(26)23-12-6-9-4-3-5-10(17(27)28)14(9)30-19(12)29/h3-5,7-8,12,29H,6H2,1-2H3,(H2,20,22)(H,21,25)(H,23,26)(H,27,28)/b24-13-/t8?,12-/m0/s1 |
| InChIKey | LXXRJJZARAMMAJ-QHYUFPEPSA-N |
| XLogP | -0.58 |
| TPSA | 185.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|