C14H13BN4O6S — CID 142485377
(3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-5-yl)-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 142485377) has the molecular formula C14H13BN4O6S and a molecular weight of 376.16 g/mol. Its IUPAC name is (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-5-yl)-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-5-yl)-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 142485377 |
| Molecular Formula | C14H13BN4O6S |
| Molecular Weight | 376.16 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | (3R)-3-[[(2Z)-2-(2-amino-1,3-thiazol-5-yl)-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | Nc1ncc(/C(=N\O)C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)s1 |
| InChI | InChI=1S/C14H13BN4O6S/c16-14-17-5-8(26-14)10(19-24)12(20)18-9-4-6-2-1-3-7(13(21)22)11(6)25-15(9)23/h1-3,5,9,23-24H,4H2,(H2,16,17)(H,18,20)(H,21,22)/b19-10+/t9-/m0/s1 |
| InChIKey | SVSAOVQPNVOCGG-XHYWODOQSA-N |
| XLogP | -0.26 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.16 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|