C16H15BN4O6 — CID 142485079
(3R)-3-[[(2Z)-2-(2-amino-4-pyridinyl)-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 142485079) has the molecular formula C16H15BN4O6 and a molecular weight of 370.13 g/mol. Its IUPAC name is (3R)-3-[[(2Z)-2-(2-amino-4-pyridinyl)-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2Z)-2-(2-amino-4-pyridinyl)-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 142485079 |
| Molecular Formula | C16H15BN4O6 |
| Molecular Weight | 370.13 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (3R)-3-[[(2Z)-2-(2-amino-4-pyridinyl)-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | Nc1cc(/C(=N/O)C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)ccn1 |
| InChI | InChI=1S/C16H15BN4O6/c18-12-7-8(4-5-19-12)13(21-26)15(22)20-11-6-9-2-1-3-10(16(23)24)14(9)27-17(11)25/h1-5,7,11,25-26H,6H2,(H2,18,19)(H,20,22)(H,23,24)/b21-13-/t11-/m0/s1 |
| InChIKey | WCVIAZMAAGZDTC-LZZRXTTCSA-N |
| XLogP | -0.32 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.13 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|