C17H16BN3O6 — CID 158499025
(3R)-3-[(3Z)-3-(2-amino-4-pyridinyl)-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 158499025) has the molecular formula C17H16BN3O6 and a molecular weight of 369.14 g/mol. Its IUPAC name is (3R)-3-[(3Z)-3-(2-amino-4-pyridinyl)-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[(3Z)-3-(2-amino-4-pyridinyl)-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 158499025 |
| Molecular Formula | C17H16BN3O6 |
| Molecular Weight | 369.14 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (3R)-3-[(3Z)-3-(2-amino-4-pyridinyl)-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | Nc1cc(/C(=N/O)C(=O)C[C@H]2Cc3cccc(C(=O)O)c3OB2O)ccn1 |
| InChI | InChI=1S/C17H16BN3O6/c19-14-7-9(4-5-20-14)15(21-26)13(22)8-11-6-10-2-1-3-12(17(23)24)16(10)27-18(11)25/h1-5,7,11,25-26H,6,8H2,(H2,19,20)(H,23,24)/b21-15-/t11-/m1/s1 |
| InChIKey | HTHVLDYXSWKRLU-CIFSEPIQSA-N |
| XLogP | 0.99 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.14 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|