C15H13BN2O6S2 — CID 172939281
(3R)-2-hydroxy-3-[(3Z)-3-hydroxyimino-2-oxo-3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)propyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 172939281) has the molecular formula C15H13BN2O6S2 and a molecular weight of 392.22 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-[(3Z)-3-hydroxyimino-2-oxo-3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)propyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-[(3Z)-3-hydroxyimino-2-oxo-3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)propyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 172939281 |
| Molecular Formula | C15H13BN2O6S2 |
| Molecular Weight | 392.22 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | (3R)-2-hydroxy-3-[(3Z)-3-hydroxyimino-2-oxo-3-(2-sulfanylidene-3H-1,3-thiazol-4-yl)propyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | O=C(C[C@H]1Cc2cccc(C(=O)O)c2OB1O)/C(=N\O)c1csc(=S)[nH]1 |
| InChI | InChI=1S/C15H13BN2O6S2/c19-11(12(18-23)10-6-26-15(25)17-10)5-8-4-7-2-1-3-9(14(20)21)13(7)24-16(8)22/h1-3,6,8,22-23H,4-5H2,(H,17,25)(H,20,21)/b18-12-/t8-/m1/s1 |
| InChIKey | SUUAEOCEKWSESJ-RMKINNOESA-N |
| XLogP | 2.13 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|