C17H20BN3O5S — CID 172971236
(1Z)-1-[2-(2-hydroxyethylamino)-1,3-thiazol-4-yl]-1-hydroxyimino-3-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]propan-2-one (PubChem CID 172971236) has the molecular formula C17H20BN3O5S and a molecular weight of 389.24 g/mol. Its IUPAC name is (1Z)-1-[2-(2-hydroxyethylamino)-1,3-thiazol-4-yl]-1-hydroxyimino-3-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]propan-2-one.
| Compound Name | (1Z)-1-[2-(2-hydroxyethylamino)-1,3-thiazol-4-yl]-1-hydroxyimino-3-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]propan-2-one |
|---|---|
| PubChem CID | 172971236 |
| Molecular Formula | C17H20BN3O5S |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (1Z)-1-[2-(2-hydroxyethylamino)-1,3-thiazol-4-yl]-1-hydroxyimino-3-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]propan-2-one |
| SMILES | Cc1cccc2c1OB(O)[C@@H](CC(=O)/C(=N\O)c1csc(NCCO)n1)C2 |
| InChI | InChI=1S/C17H20BN3O5S/c1-10-3-2-4-11-7-12(18(24)26-16(10)11)8-14(23)15(21-25)13-9-27-17(20-13)19-5-6-22/h2-4,9,12,22,24-25H,5-8H2,1H3,(H,19,20)/b21-15-/t12-/m1/s1 |
| InChIKey | JGMZMVPTETVQII-DMJQWXIHSA-N |
| XLogP | 1.48 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|