C15H16BN3O4S — CID 159129801
(1Z)-1-(2-amino-1,3-thiazol-4-yl)-1-hydroxyimino-3-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]propan-2-one (PubChem CID 159129801) has the molecular formula C15H16BN3O4S and a molecular weight of 345.19 g/mol. Its IUPAC name is (1Z)-1-(2-amino-1,3-thiazol-4-yl)-1-hydroxyimino-3-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]propan-2-one.
| Compound Name | (1Z)-1-(2-amino-1,3-thiazol-4-yl)-1-hydroxyimino-3-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]propan-2-one |
|---|---|
| PubChem CID | 159129801 |
| Molecular Formula | C15H16BN3O4S |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (1Z)-1-(2-amino-1,3-thiazol-4-yl)-1-hydroxyimino-3-[(3R)-2-hydroxy-8-methyl-3,4-dihydro-1,2-benzoxaborinin-3-yl]propan-2-one |
| SMILES | Cc1cccc2c1OB(O)[C@@H](CC(=O)/C(=N\O)c1csc(N)n1)C2 |
| InChI | InChI=1S/C15H16BN3O4S/c1-8-3-2-4-9-5-10(16(21)23-14(8)9)6-12(20)13(19-22)11-7-24-15(17)18-11/h2-4,7,10,21-22H,5-6H2,1H3,(H2,17,18)/b19-13-/t10-/m1/s1 |
| InChIKey | XTTRNOZINFMHKI-ICHPLGEASA-N |
| XLogP | 1.66 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|