C23H29BN4O6S — CID 172941190
(3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-7-[(4-ethylpiperidin-1-yl)methyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 172941190) has the molecular formula C23H29BN4O6S and a molecular weight of 500.39 g/mol. Its IUPAC name is (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-7-[(4-ethylpiperidin-1-yl)methyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-7-[(4-ethylpiperidin-1-yl)methyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 172941190 |
| Molecular Formula | C23H29BN4O6S |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-7-[(4-ethylpiperidin-1-yl)methyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCC1CCN(Cc2ccc3c(c2C(=O)O)OB(O)[C@@H](CC(=O)/C(=N\O)c2csc(N)n2)C3)CC1 |
| InChI | InChI=1S/C23H29BN4O6S/c1-2-13-5-7-28(8-6-13)11-15-4-3-14-9-16(24(32)34-21(14)19(15)22(30)31)10-18(29)20(27-33)17-12-35-23(25)26-17/h3-4,12-13,16,32-33H,2,5-11H2,1H3,(H2,25,26)(H,30,31)/b27-20-/t16-/m1/s1 |
| InChIKey | UCYFQVSQZILBEQ-FHPLLVLXSA-N |
| XLogP | 2.67 |
| TPSA | 158.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|