C16H22BN3O8S — CID 146982392
2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(3R,6S)-6-(carboxymethyl)-2-hydroxyoxaborinan-3-yl]-2-oxopropylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 146982392) has the molecular formula C16H22BN3O8S and a molecular weight of 427.24 g/mol. Its IUPAC name is 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(3R,6S)-6-(carboxymethyl)-2-hydroxyoxaborinan-3-yl]-2-oxopropylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(3R,6S)-6-(carboxymethyl)-2-hydroxyoxaborinan-3-yl]-2-oxopropylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 146982392 |
| Molecular Formula | C16H22BN3O8S |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-3-[(3R,6S)-6-(carboxymethyl)-2-hydroxyoxaborinan-3-yl]-2-oxopropylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CC(C)(O/N=C(/C(=O)C[C@H]1CC[C@@H](CC(=O)O)OB1O)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C16H22BN3O8S/c1-16(2,14(24)25)28-20-13(10-7-29-15(18)19-10)11(21)5-8-3-4-9(6-12(22)23)27-17(8)26/h7-9,26H,3-6H2,1-2H3,(H2,18,19)(H,22,23)(H,24,25)/b20-13+/t8-,9+/m1/s1 |
| InChIKey | AOOKWKGDSOKQCY-XVMARUQCSA-N |
| XLogP | 0.77 |
| TPSA | 181.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|