C18H21BN4O9S — CID 148543916
2-[(3R,6S)-3-[(3E)-3-(2-amino-1,3-thiazol-4-yl)-3-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-2-oxopropyl]-2-hydroxyoxaborinan-6-yl]acetic acid (PubChem CID 148543916) has the molecular formula C18H21BN4O9S and a molecular weight of 480.26 g/mol. Its IUPAC name is 2-[(3R,6S)-3-[(3E)-3-(2-amino-1,3-thiazol-4-yl)-3-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-2-oxopropyl]-2-hydroxyoxaborinan-6-yl]acetic acid.
| Compound Name | 2-[(3R,6S)-3-[(3E)-3-(2-amino-1,3-thiazol-4-yl)-3-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-2-oxopropyl]-2-hydroxyoxaborinan-6-yl]acetic acid |
|---|---|
| PubChem CID | 148543916 |
| Molecular Formula | C18H21BN4O9S |
| Molecular Weight | 480.26 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-[(3R,6S)-3-[(3E)-3-(2-amino-1,3-thiazol-4-yl)-3-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyimino]-2-oxopropyl]-2-hydroxyoxaborinan-6-yl]acetic acid |
| SMILES | Nc1nc(/C(=N\OCc2cc(=O)c(O)cn2O)C(=O)C[C@H]2CC[C@@H](CC(=O)O)OB2O)cs1 |
| InChI | InChI=1S/C18H21BN4O9S/c20-18-21-12(8-33-18)17(22-31-7-10-4-13(24)15(26)6-23(10)30)14(25)3-9-1-2-11(5-16(27)28)32-19(9)29/h4,6,8-9,11,26,29-30H,1-3,5,7H2,(H2,20,21)(H,27,28)/b22-17+/t9-,11+/m1/s1 |
| InChIKey | MSSNRKMBYBFMRN-OZOFKVISSA-N |
| XLogP | 0.21 |
| TPSA | 206.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|