C15H18F3N5O7S — CID 139025899
2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3S)-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 139025899) has the molecular formula C15H18F3N5O7S and a molecular weight of 469.40 g/mol. Its IUPAC name is 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3S)-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3S)-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 139025899 |
| Molecular Formula | C15H18F3N5O7S |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 2-[(Z)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3S)-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C[C@H]1NC(=O)[C@H]1NC(=O)/C(=N\OC(C)(C)C(=O)O)c1csc(N)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H17N5O5S.C2HF3O2/c1-5-7(9(19)15-5)17-10(20)8(6-4-24-12(14)16-6)18-23-13(2,3)11(21)22;3-2(4,5)1(6)7/h4-5,7H,1-3H3,(H2,14,16)(H,15,19)(H,17,20)(H,21,22);(H,6,7)/b18-8-;/t5-,7+;/m1./s1 |
| InChIKey | AIJPQIJBIFKMOA-YVYWXSIHSA-N |
| XLogP | -0.05 |
| TPSA | 193.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|