C14H19N5O5S — CID 172934433
2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S,4S)-3-methyl-6-oxa-2-azabicyclo[3.1.0]hexan-4-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 172934433) has the molecular formula C14H19N5O5S and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S,4S)-3-methyl-6-oxa-2-azabicyclo[3.1.0]hexan-4-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S,4S)-3-methyl-6-oxa-2-azabicyclo[3.1.0]hexan-4-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 172934433 |
| Molecular Formula | C14H19N5O5S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(3S,4S)-3-methyl-6-oxa-2-azabicyclo[3.1.0]hexan-4-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | C[C@@H]1NC2OC2[C@H]1NC(=O)/C(=N/OC(C)(C)C(=O)O)c1csc(N)n1 |
| InChI | InChI=1S/C14H19N5O5S/c1-5-7(9-11(16-5)23-9)18-10(20)8(6-4-25-13(15)17-6)19-24-14(2,3)12(21)22/h4-5,7,9,11,16H,1-3H3,(H2,15,17)(H,18,20)(H,21,22)/b19-8+/t5-,7-,9?,11?/m0/s1 |
| InChIKey | ZZJHXICMKWDRAV-RQRDMKGOSA-N |
| XLogP | -0.49 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|