C18H16BN3O8S — CID 172946064
(3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-7-[(E)-2-carboxyethenyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 172946064) has the molecular formula C18H16BN3O8S and a molecular weight of 445.22 g/mol. Its IUPAC name is (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-7-[(E)-2-carboxyethenyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-7-[(E)-2-carboxyethenyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 172946064 |
| Molecular Formula | C18H16BN3O8S |
| Molecular Weight | 445.22 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-7-[(E)-2-carboxyethenyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | Nc1nc(/C(=N/O)C(=O)C[C@H]2Cc3ccc(/C=C/C(=O)O)c(C(=O)O)c3OB2O)cs1 |
| InChI | InChI=1S/C18H16BN3O8S/c20-18-21-11(7-31-18)15(22-29)12(23)6-10-5-9-2-1-8(3-4-13(24)25)14(17(26)27)16(9)30-19(10)28/h1-4,7,10,28-29H,5-6H2,(H2,20,21)(H,24,25)(H,26,27)/b4-3+,22-15-/t10-/m1/s1 |
| InChIKey | YYMNDZNXQGONPY-GURQUCQFSA-N |
| XLogP | 1.14 |
| TPSA | 192.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|