C19H24BN5O6S — CID 172937878
(3R)-3-[(3Z)-3-[2-[bis(2-aminoethyl)amino]-1,3-thiazol-4-yl]-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 172937878) has the molecular formula C19H24BN5O6S and a molecular weight of 461.31 g/mol. Its IUPAC name is (3R)-3-[(3Z)-3-[2-[bis(2-aminoethyl)amino]-1,3-thiazol-4-yl]-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[(3Z)-3-[2-[bis(2-aminoethyl)amino]-1,3-thiazol-4-yl]-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 172937878 |
| Molecular Formula | C19H24BN5O6S |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | (3R)-3-[(3Z)-3-[2-[bis(2-aminoethyl)amino]-1,3-thiazol-4-yl]-3-hydroxyimino-2-oxopropyl]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NCCN(CCN)c1nc(/C(=N/O)C(=O)C[C@H]2Cc3cccc(C(=O)O)c3OB2O)cs1 |
| InChI | InChI=1S/C19H24BN5O6S/c21-4-6-25(7-5-22)19-23-14(10-32-19)16(24-30)15(26)9-12-8-11-2-1-3-13(18(27)28)17(11)31-20(12)29/h1-3,10,12,29-30H,4-9,21-22H2,(H,27,28)/b24-16-/t12-/m1/s1 |
| InChIKey | KLZZTOZNWLANBP-CBKNWECGSA-N |
| XLogP | 0.19 |
| TPSA | 184.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|