C18H20BN3O6S — CID 172931354
(3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-2-hydroxy-6-propyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 172931354) has the molecular formula C18H20BN3O6S and a molecular weight of 417.25 g/mol. Its IUPAC name is (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-2-hydroxy-6-propyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-2-hydroxy-6-propyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 172931354 |
| Molecular Formula | C18H20BN3O6S |
| Molecular Weight | 417.25 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (3R)-3-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-hydroxyimino-2-oxopropyl]-2-hydroxy-6-propyl-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCCc1cc2c(c(C(=O)O)c1)OB(O)[C@@H](CC(=O)/C(=N\O)c1csc(N)n1)C2 |
| InChI | InChI=1S/C18H20BN3O6S/c1-2-3-9-4-10-6-11(19(26)28-16(10)12(5-9)17(24)25)7-14(23)15(22-27)13-8-29-18(20)21-13/h4-5,8,11,26-27H,2-3,6-7H2,1H3,(H2,20,21)(H,24,25)/b22-15-/t11-/m1/s1 |
| InChIKey | RNHHIMNZNWXAPF-MBCVGUBISA-N |
| XLogP | 2.00 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|