C18H18BN3O6 — CID 75299236
3-[[2-[4-(aminomethyl)phenyl]-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 75299236) has the molecular formula C18H18BN3O6 and a molecular weight of 383.17 g/mol. Its IUPAC name is 3-[[2-[4-(aminomethyl)phenyl]-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 3-[[2-[4-(aminomethyl)phenyl]-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 75299236 |
| Molecular Formula | C18H18BN3O6 |
| Molecular Weight | 383.17 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 3-[[2-[4-(aminomethyl)phenyl]-2-hydroxyiminoacetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NCc1ccc(C(=NO)C(=O)NC2Cc3cccc(C(=O)O)c3OB2O)cc1 |
| InChI | InChI=1S/C18H18BN3O6/c20-9-10-4-6-11(7-5-10)15(22-27)17(23)21-14-8-12-2-1-3-13(18(24)25)16(12)28-19(14)26/h1-7,14,26-27H,8-9,20H2,(H,21,23)(H,24,25) |
| InChIKey | VBBONZSDVJRKGD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 154.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.17 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|