C20H24BN3O5 — CID 75298880
3-[[2-[4-[(2-aminoethylamino)methyl]phenyl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 75298880) has the molecular formula C20H24BN3O5 and a molecular weight of 397.24 g/mol. Its IUPAC name is 3-[[2-[4-[(2-aminoethylamino)methyl]phenyl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | 3-[[2-[4-[(2-aminoethylamino)methyl]phenyl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 75298880 |
| Molecular Formula | C20H24BN3O5 |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-[[2-[4-[(2-aminoethylamino)methyl]phenyl]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NCCNCc1ccc(CC(=O)NC2Cc3cccc(C(=O)O)c3OB2O)cc1 |
| InChI | InChI=1S/C20H24BN3O5/c22-8-9-23-12-14-6-4-13(5-7-14)10-18(25)24-17-11-15-2-1-3-16(20(26)27)19(15)29-21(17)28/h1-7,17,23,28H,8-12,22H2,(H,24,25)(H,26,27) |
| InChIKey | QDJQPDRNQNLNAP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|