C12H16BN3O7S — CID 149203714
(3R)-2-hydroxy-3-[3-(sulfamoylamino)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 149203714) has the molecular formula C12H16BN3O7S and a molecular weight of 357.15 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-[3-(sulfamoylamino)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-[3-(sulfamoylamino)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 149203714 |
| Molecular Formula | C12H16BN3O7S |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (3R)-2-hydroxy-3-[3-(sulfamoylamino)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | NS(=O)(=O)NCCC(=O)N[C@H]1Cc2cccc(C(=O)O)c2OB1O |
| InChI | InChI=1S/C12H16BN3O7S/c14-24(21,22)15-5-4-10(17)16-9-6-7-2-1-3-8(12(18)19)11(7)23-13(9)20/h1-3,9,15,20H,4-6H2,(H,16,17)(H,18,19)(H2,14,21,22)/t9-/m0/s1 |
| InChIKey | XFERZVCWFVILBH-VIFPVBQESA-N |
| XLogP | -1.99 |
| TPSA | 168.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|