C19H27BN2O9S — CID 140739735
2,2-dimethylpropanoyloxymethyl (3R)-2-hydroxy-3-[3-(methanesulfonamido)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 140739735) has the molecular formula C19H27BN2O9S and a molecular weight of 470.31 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (3R)-2-hydroxy-3-[3-(methanesulfonamido)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (3R)-2-hydroxy-3-[3-(methanesulfonamido)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 140739735 |
| Molecular Formula | C19H27BN2O9S |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (3R)-2-hydroxy-3-[3-(methanesulfonamido)propanoylamino]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CCNS(C)(=O)=O)C2 |
| InChI | InChI=1S/C19H27BN2O9S/c1-19(2,3)18(25)30-11-29-17(24)13-7-5-6-12-10-14(20(26)31-16(12)13)22-15(23)8-9-21-32(4,27)28/h5-7,14,21,26H,8-11H2,1-4H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | RETXLMQGHWNJEG-AWEZNQCLSA-N |
| XLogP | -0.23 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|