C19H26BNO7S — CID 140925464
(2-ethylsulfanyl-2-methylpropanoyl)oxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 140925464) has the molecular formula C19H26BNO7S and a molecular weight of 423.30 g/mol. Its IUPAC name is (2-ethylsulfanyl-2-methylpropanoyl)oxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | (2-ethylsulfanyl-2-methylpropanoyl)oxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 140925464 |
| Molecular Formula | C19H26BNO7S |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | (2-ethylsulfanyl-2-methylpropanoyl)oxymethyl (3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCSC(C)(C)C(=O)OCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CC)C2 |
| InChI | InChI=1S/C19H26BNO7S/c1-5-15(22)21-14-10-12-8-7-9-13(16(12)28-20(14)25)17(23)26-11-27-18(24)19(3,4)29-6-2/h7-9,14,25H,5-6,10-11H2,1-4H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | HALAPLCAGQPKQM-AWEZNQCLSA-N |
| XLogP | 1.73 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|