C18H22BNO9 — CID 140925523
4-O-[[(3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carbonyl]oxymethyl] 1-O-methyl butanedioate (PubChem CID 140925523) has the molecular formula C18H22BNO9 and a molecular weight of 407.18 g/mol. Its IUPAC name is 4-O-[[(3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carbonyl]oxymethyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[[(3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carbonyl]oxymethyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 140925523 |
| Molecular Formula | C18H22BNO9 |
| Molecular Weight | 407.18 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 4-O-[[(3R)-2-hydroxy-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carbonyl]oxymethyl] 1-O-methyl butanedioate |
| SMILES | CCC(=O)N[C@H]1Cc2cccc(C(=O)OCOC(=O)CCC(=O)OC)c2OB1O |
| InChI | InChI=1S/C18H22BNO9/c1-3-14(21)20-13-9-11-5-4-6-12(17(11)29-19(13)25)18(24)28-10-27-16(23)8-7-15(22)26-2/h4-6,13,25H,3,7-10H2,1-2H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | WIBLMYBZODKCAS-ZDUSSCGKSA-N |
| XLogP | 0.15 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.18 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|