C22H22BF2NO7 — CID 140925437
benzoyloxymethyl (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 140925437) has the molecular formula C22H22BF2NO7 and a molecular weight of 461.23 g/mol. Its IUPAC name is benzoyloxymethyl (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | benzoyloxymethyl (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 140925437 |
| Molecular Formula | C22H22BF2NO7 |
| Molecular Weight | 461.23 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | benzoyloxymethyl (3R)-3-(4,4-difluoropentanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC(F)(F)CCC(=O)N[C@H]1Cc2cccc(C(=O)OCOC(=O)c3ccccc3)c2OB1O |
| InChI | InChI=1S/C22H22BF2NO7/c1-22(24,25)11-10-18(27)26-17-12-15-8-5-9-16(19(15)33-23(17)30)21(29)32-13-31-20(28)14-6-3-2-4-7-14/h2-9,17,30H,10-13H2,1H3,(H,26,27)/t17-/m0/s1 |
| InChIKey | FRCTYLDNAYKILK-KRWDZBQOSA-N |
| XLogP | 2.53 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|