C17H20BF2NO8 — CID 145329361
ethoxycarbonyloxymethyl (3R)-3-(2,2-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329361) has the molecular formula C17H20BF2NO8 and a molecular weight of 415.15 g/mol. Its IUPAC name is ethoxycarbonyloxymethyl (3R)-3-(2,2-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | ethoxycarbonyloxymethyl (3R)-3-(2,2-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329361 |
| Molecular Formula | C17H20BF2NO8 |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | ethoxycarbonyloxymethyl (3R)-3-(2,2-difluorobutanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCOC(=O)OCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)C(F)(F)CC)C2 |
| InChI | InChI=1S/C17H20BF2NO8/c1-3-17(19,20)15(23)21-12-8-10-6-5-7-11(13(10)29-18(12)25)14(22)27-9-28-16(24)26-4-2/h5-7,12,25H,3-4,8-9H2,1-2H3,(H,21,23)/t12-/m0/s1 |
| InChIKey | RLWOQUFOJRPVSY-LBPRGKRZSA-N |
| XLogP | 1.46 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|