C19H26BNO8 — CID 145329109
butoxycarbonyloxymethyl (3R)-3-(butanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 145329109) has the molecular formula C19H26BNO8 and a molecular weight of 407.23 g/mol. Its IUPAC name is butoxycarbonyloxymethyl (3R)-3-(butanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | butoxycarbonyloxymethyl (3R)-3-(butanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 145329109 |
| Molecular Formula | C19H26BNO8 |
| Molecular Weight | 407.23 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | butoxycarbonyloxymethyl (3R)-3-(butanoylamino)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCCOC(=O)OCOC(=O)c1cccc2c1OB(O)[C@@H](NC(=O)CCC)C2 |
| InChI | InChI=1S/C19H26BNO8/c1-3-5-10-26-19(24)28-12-27-18(23)14-9-6-8-13-11-15(20(25)29-17(13)14)21-16(22)7-4-2/h6,8-9,15,25H,3-5,7,10-12H2,1-2H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | FMFGINKBUWJVGA-HNNXBMFYSA-N |
| XLogP | 1.99 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|