C21H27BO9 — CID 147064148
butoxycarbonyloxymethyl (3R)-3-(2,5-dioxohexyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 147064148) has the molecular formula C21H27BO9 and a molecular weight of 434.25 g/mol. Its IUPAC name is butoxycarbonyloxymethyl (3R)-3-(2,5-dioxohexyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | butoxycarbonyloxymethyl (3R)-3-(2,5-dioxohexyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 147064148 |
| Molecular Formula | C21H27BO9 |
| Molecular Weight | 434.25 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | butoxycarbonyloxymethyl (3R)-3-(2,5-dioxohexyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CCCCOC(=O)OCOC(=O)c1cccc2c1OB(O)[C@@H](CC(=O)CCC(C)=O)C2 |
| InChI | InChI=1S/C21H27BO9/c1-3-4-10-28-21(26)30-13-29-20(25)18-7-5-6-15-11-16(22(27)31-19(15)18)12-17(24)9-8-14(2)23/h5-7,16,27H,3-4,8-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | BDSYNSKTOMWZPI-MRXNPFEDSA-N |
| XLogP | 2.87 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|