C19H23BO8 — CID 157245149
acetyloxymethyl (3R)-3-(2,6-dioxoheptyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate (PubChem CID 157245149) has the molecular formula C19H23BO8 and a molecular weight of 390.20 g/mol. Its IUPAC name is acetyloxymethyl (3R)-3-(2,6-dioxoheptyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate.
| Compound Name | acetyloxymethyl (3R)-3-(2,6-dioxoheptyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
|---|---|
| PubChem CID | 157245149 |
| Molecular Formula | C19H23BO8 |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | acetyloxymethyl (3R)-3-(2,6-dioxoheptyl)-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylate |
| SMILES | CC(=O)CCCC(=O)C[C@H]1Cc2cccc(C(=O)OCOC(C)=O)c2OB1O |
| InChI | InChI=1S/C19H23BO8/c1-12(21)5-3-7-16(23)10-15-9-14-6-4-8-17(18(14)28-20(15)25)19(24)27-11-26-13(2)22/h4,6,8,15,25H,3,5,7,9-11H2,1-2H3/t15-/m1/s1 |
| InChIKey | ZBBRZYQDLWPFKG-OAHLLOKOSA-N |
| XLogP | 1.87 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|